C80H142N6O3 — CID 168796225
[1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-yl] 6-[3-[bis[(Z)-octadec-9-enyl]amino]propyl-[(Z)-octadec-9-enyl]amino]hexanoate (PubChem CID 168796225) has the molecular formula C80H142N6O3 and a molecular weight of 1236.05 g/mol. Its IUPAC name is [1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-yl] 6-[3-[bis[(Z)-octadec-9-enyl]amino]propyl-[(Z)-octadec-9-enyl]amino]hexanoate.
| Compound Name | [1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-yl] 6-[3-[bis[(Z)-octadec-9-enyl]amino]propyl-[(Z)-octadec-9-enyl]amino]hexanoate |
|---|---|
| PubChem CID | 168796225 |
| Molecular Formula | C80H142N6O3 |
| Molecular Weight | 1236.05 g/mol |
| Exact Mass | 1235.11 |
| IUPAC Name | [1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-yl] 6-[3-[bis[(Z)-octadec-9-enyl]amino]propyl-[(Z)-octadec-9-enyl]amino]hexanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN(CCCCCCCC/C=C\CCCCCCCC)CCCN(CCCCCCCC/C=C\CCCCCCCC)CCCCCC(=O)OC(C)(C)Cn1c(COCC)nc2c(N)nc3ccccc3c21 |
| InChI | InChI=1S/C80H142N6O3/c1-7-11-14-17-20-23-26-29-32-35-38-41-44-47-50-57-65-84(66-58-51-48-45-42-39-36-33-30-27-24-21-18-15-12-8-2)69-61-70-85(67-59-52-49-46-43-40-37-34-31-28-25-22-19-16-13-9-3)68-60-53-54-64-76(87)89-80(5,6)72-86-75(71-88-10-4)83-77-78(86)73-62-55-56-63-74(73)82-79(77)81/h29-34,55-56,62-63H,7-28,35-54,57-61,64-72H2,1-6H3,(H2,81,82)/b32-29-,33-30-,34-31- |
| InChIKey | IFFYJFPWLYFYEA-SBPTYLIASA-N |
| XLogP | 23.69 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 64 |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1236.05 |
| LogP ≤ 5 | 23.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|