C31H39N7O7 — CID 71615998
[1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-yl] 2-[2-[2-[[4-(hydrazinecarbonyl)benzoyl]amino]ethoxy]ethoxy]acetate (PubChem CID 71615998) has the molecular formula C31H39N7O7 and a molecular weight of 621.70 g/mol. Its IUPAC name is [1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-yl] 2-[2-[2-[[4-(hydrazinecarbonyl)benzoyl]amino]ethoxy]ethoxy]acetate.
| Compound Name | [1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-yl] 2-[2-[2-[[4-(hydrazinecarbonyl)benzoyl]amino]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 71615998 |
| Molecular Formula | C31H39N7O7 |
| Molecular Weight | 621.70 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | [1-[4-amino-2-(ethoxymethyl)imidazo[4,5-c]quinolin-1-yl]-2-methylpropan-2-yl] 2-[2-[2-[[4-(hydrazinecarbonyl)benzoyl]amino]ethoxy]ethoxy]acetate |
| SMILES | CCOCc1nc2c(N)nc3ccccc3c2n1CC(C)(C)OC(=O)COCCOCCNC(=O)c1ccc(C(=O)NN)cc1 |
| InChI | InChI=1S/C31H39N7O7/c1-4-42-17-24-36-26-27(22-7-5-6-8-23(22)35-28(26)32)38(24)19-31(2,3)45-25(39)18-44-16-15-43-14-13-34-29(40)20-9-11-21(12-10-20)30(41)37-33/h5-12H,4,13-19,33H2,1-3H3,(H2,32,35)(H,34,40)(H,37,41) |
| InChIKey | RHIFCTWJWRVVKA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 194.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.70 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|