C17H30O — CID 168803453
(2S,3R,6S,7R)-2,3,6,7-tetramethyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-xanthene (PubChem CID 168803453) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is (2S,3R,6S,7R)-2,3,6,7-tetramethyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-xanthene.
| Compound Name | (2S,3R,6S,7R)-2,3,6,7-tetramethyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-xanthene |
|---|---|
| PubChem CID | 168803453 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | (2S,3R,6S,7R)-2,3,6,7-tetramethyl-2,3,4,4a,5,6,7,8,8a,9,9a,10a-dodecahydro-1H-xanthene |
| SMILES | C[C@@H]1CC2OC3C[C@H](C)[C@H](C)CC3CC2C[C@@H]1C |
| InChI | InChI=1S/C17H30O/c1-10-5-14-9-15-6-11(2)13(4)8-17(15)18-16(14)7-12(10)3/h10-17H,5-9H2,1-4H3/t10-,11+,12+,13-,14?,15?,16?,17? |
| InChIKey | LDFBQERXVFAMAO-DVVFYMAVSA-N |
| XLogP | 4.51 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |