C43H29N3O5 — CID 168812303
2-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-[3-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-4-yl)phenyl]xanthen-9-one (PubChem CID 168812303) has the molecular formula C43H29N3O5 and a molecular weight of 667.72 g/mol. Its IUPAC name is 2-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-[3-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-4-yl)phenyl]xanthen-9-one.
| Compound Name | 2-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-[3-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-4-yl)phenyl]xanthen-9-one |
|---|---|
| PubChem CID | 168812303 |
| Molecular Formula | C43H29N3O5 |
| Molecular Weight | 667.72 g/mol |
| Exact Mass | 667.21 |
| IUPAC Name | 2-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-7-[3-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-4-yl)phenyl]xanthen-9-one |
| SMILES | CC(C)(C)c1nnc(-c2ccc3oc4ccc(-c5cccc(-c6ccc7c(c6)N6c8ccccc8Oc8cccc(c86)O7)c5)cc4c(=O)c3c2)o1 |
| InChI | InChI=1S/C43H29N3O5/c1-43(2,3)42-45-44-41(51-42)28-16-18-34-30(22-28)40(47)29-21-26(14-17-33(29)48-34)24-8-6-9-25(20-24)27-15-19-36-32(23-27)46-31-10-4-5-11-35(31)49-37-12-7-13-38(50-36)39(37)46/h4-23H,1-3H3 |
| InChIKey | YVSZZPJAVHUBLZ-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 90.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.72 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|