C46H41NO4Si — CID 168812428
2-[3-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-5-yl)phenyl]-7-tri(propan-2-yl)silylxanthen-9-one (PubChem CID 168812428) has the molecular formula C46H41NO4Si and a molecular weight of 699.92 g/mol. Its IUPAC name is 2-[3-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-5-yl)phenyl]-7-tri(propan-2-yl)silylxanthen-9-one.
| Compound Name | 2-[3-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-5-yl)phenyl]-7-tri(propan-2-yl)silylxanthen-9-one |
|---|---|
| PubChem CID | 168812428 |
| Molecular Formula | C46H41NO4Si |
| Molecular Weight | 699.92 g/mol |
| Exact Mass | 699.28 |
| IUPAC Name | 2-[3-(8,14-dioxa-1-azapentacyclo[11.7.1.02,7.09,21.015,20]henicosa-2(7),3,5,9,11,13(21),15,17,19-nonaen-5-yl)phenyl]-7-tri(propan-2-yl)silylxanthen-9-one |
| SMILES | CC(C)[Si](c1ccc2oc3ccc(-c4cccc(-c5ccc6c(c5)Oc5cccc7c5N6c5ccccc5O7)c4)cc3c(=O)c2c1)(C(C)C)C(C)C |
| InChI | InChI=1S/C46H41NO4Si/c1-27(2)52(28(3)4,29(5)6)34-19-22-40-36(26-34)46(48)35-24-32(18-21-39(35)49-40)30-11-9-12-31(23-30)33-17-20-38-44(25-33)51-43-16-10-15-42-45(43)47(38)37-13-7-8-14-41(37)50-42/h7-29H,1-6H3 |
| InChIKey | RWFKZBVIGICCFO-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.92 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|