C28H19F3IrN3 — CID 168821846
5,6,10,10b-tetrahydroimidazo[2,1-a]isoquinoline-1,10-diide;iridium(3+);3-phenyl-2-(2,4,5-trifluorobenzene-6-id-1-yl)pyridine (PubChem CID 168821846) has the molecular formula C28H19F3IrN3 and a molecular weight of 646.69 g/mol. Its IUPAC name is 5,6,10,10b-tetrahydroimidazo[2,1-a]isoquinoline-1,10-diide;iridium(3+);3-phenyl-2-(2,4,5-trifluorobenzene-6-id-1-yl)pyridine.
| Compound Name | 5,6,10,10b-tetrahydroimidazo[2,1-a]isoquinoline-1,10-diide;iridium(3+);3-phenyl-2-(2,4,5-trifluorobenzene-6-id-1-yl)pyridine |
|---|---|
| PubChem CID | 168821846 |
| Molecular Formula | C28H19F3IrN3 |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 647.12 |
| IUPAC Name | 5,6,10,10b-tetrahydroimidazo[2,1-a]isoquinoline-1,10-diide;iridium(3+);3-phenyl-2-(2,4,5-trifluorobenzene-6-id-1-yl)pyridine |
| SMILES | Fc1[c-]c(-c2ncccc2-c2ccccc2)c(F)cc1F.[Ir+3].[c-]1cccc2c1C1[N-]C=CN1CC2 |
| InChI | InChI=1S/C17H9F3N.C11H10N2.Ir/c18-14-10-16(20)15(19)9-13(14)17-12(7-4-8-21-17)11-5-2-1-3-6-11;1-2-4-10-9(3-1)5-7-13-8-6-12-11(10)13;/h1-8,10H;1-3,6,8,11H,5,7H2;/q-1;-2;+3 |
| InChIKey | XVDNRYISIWBGBC-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 30.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|