C32H25F3IrN2-2 — CID 168823026
iridium;5-methyl-2-[2,3,4-tris(fluoromethyl)benzene-6-id-1-yl]pyridine;4-phenyl-2-phenylpyridine (PubChem CID 168823026) has the molecular formula C32H25F3IrN2-2 and a molecular weight of 686.78 g/mol. Its IUPAC name is iridium;5-methyl-2-[2,3,4-tris(fluoromethyl)benzene-6-id-1-yl]pyridine;4-phenyl-2-phenylpyridine.
| Compound Name | iridium;5-methyl-2-[2,3,4-tris(fluoromethyl)benzene-6-id-1-yl]pyridine;4-phenyl-2-phenylpyridine |
|---|---|
| PubChem CID | 168823026 |
| Molecular Formula | C32H25F3IrN2-2 |
| Molecular Weight | 686.78 g/mol |
| Exact Mass | 687.16 |
| IUPAC Name | iridium;5-methyl-2-[2,3,4-tris(fluoromethyl)benzene-6-id-1-yl]pyridine;4-phenyl-2-phenylpyridine |
| SMILES | Cc1ccc(-c2[c-]cc(CF)c(CF)c2CF)nc1.[Ir].[c-]1ccccc1-c1cc(-c2ccccc2)ccn1 |
| InChI | InChI=1S/C17H12N.C15H13F3N.Ir/c1-3-7-14(8-4-1)16-11-12-18-17(13-16)15-9-5-2-6-10-15;1-10-2-5-15(19-9-10)12-4-3-11(6-16)13(7-17)14(12)8-18;/h1-9,11-13H;2-3,5,9H,6-8H2,1H3;/q2*-1; |
| InChIKey | QKSDESVGBRXYEC-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.78 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|