C19H14BrF3N4O — CID 168825304
6-(bromomethyl)-7-imidazol-1-yl-1-methyl-4-[4-(trifluoromethoxy)phenyl]benzimidazole (PubChem CID 168825304) has the molecular formula C19H14BrF3N4O and a molecular weight of 451.25 g/mol. Its IUPAC name is 6-(bromomethyl)-7-imidazol-1-yl-1-methyl-4-[4-(trifluoromethoxy)phenyl]benzimidazole.
| Compound Name | 6-(bromomethyl)-7-imidazol-1-yl-1-methyl-4-[4-(trifluoromethoxy)phenyl]benzimidazole |
|---|---|
| PubChem CID | 168825304 |
| Molecular Formula | C19H14BrF3N4O |
| Molecular Weight | 451.25 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | 6-(bromomethyl)-7-imidazol-1-yl-1-methyl-4-[4-(trifluoromethoxy)phenyl]benzimidazole |
| SMILES | Cn1cnc2c(-c3ccc(OC(F)(F)F)cc3)cc(CBr)c(-n3ccnc3)c21 |
| InChI | InChI=1S/C19H14BrF3N4O/c1-26-11-25-16-15(12-2-4-14(5-3-12)28-19(21,22)23)8-13(9-20)17(18(16)26)27-7-6-24-10-27/h2-8,10-11H,9H2,1H3 |
| InChIKey | JYTJAPNCTPSVFL-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 44.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.25 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|