C21H18F3N3O3 — CID 168825296
N-[[5-(1-hydroxyethyl)-8-[4-(trifluoromethoxy)phenyl]quinoxalin-6-yl]methyl]prop-2-enamide (PubChem CID 168825296) has the molecular formula C21H18F3N3O3 and a molecular weight of 417.39 g/mol. Its IUPAC name is N-[[5-(1-hydroxyethyl)-8-[4-(trifluoromethoxy)phenyl]quinoxalin-6-yl]methyl]prop-2-enamide.
| Compound Name | N-[[5-(1-hydroxyethyl)-8-[4-(trifluoromethoxy)phenyl]quinoxalin-6-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 168825296 |
| Molecular Formula | C21H18F3N3O3 |
| Molecular Weight | 417.39 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | N-[[5-(1-hydroxyethyl)-8-[4-(trifluoromethoxy)phenyl]quinoxalin-6-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cc(-c2ccc(OC(F)(F)F)cc2)c2nccnc2c1C(C)O |
| InChI | InChI=1S/C21H18F3N3O3/c1-3-17(29)27-11-14-10-16(13-4-6-15(7-5-13)30-21(22,23)24)19-20(18(14)12(2)28)26-9-8-25-19/h3-10,12,28H,1,11H2,2H3,(H,27,29) |
| InChIKey | NTZHOOFCQQAFPN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.39 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|