C24H23F3N2O3 — CID 168825420
tert-butyl N-[[5-ethenyl-8-[4-(trifluoromethoxy)phenyl]quinolin-6-yl]methyl]carbamate (PubChem CID 168825420) has the molecular formula C24H23F3N2O3 and a molecular weight of 444.45 g/mol. Its IUPAC name is tert-butyl N-[[5-ethenyl-8-[4-(trifluoromethoxy)phenyl]quinolin-6-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[5-ethenyl-8-[4-(trifluoromethoxy)phenyl]quinolin-6-yl]methyl]carbamate |
|---|---|
| PubChem CID | 168825420 |
| Molecular Formula | C24H23F3N2O3 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | tert-butyl N-[[5-ethenyl-8-[4-(trifluoromethoxy)phenyl]quinolin-6-yl]methyl]carbamate |
| SMILES | C=Cc1c(CNC(=O)OC(C)(C)C)cc(-c2ccc(OC(F)(F)F)cc2)c2ncccc12 |
| InChI | InChI=1S/C24H23F3N2O3/c1-5-18-16(14-29-22(30)32-23(2,3)4)13-20(21-19(18)7-6-12-28-21)15-8-10-17(11-9-15)31-24(25,26)27/h5-13H,1,14H2,2-4H3,(H,29,30) |
| InChIKey | FYQWRNVCMSDYRB-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |