C19H17F3N2O2 — CID 168905566
[7-(methylaminomethyl)-5-[4-(trifluoromethoxy)phenyl]quinolin-8-yl]methanol (PubChem CID 168905566) has the molecular formula C19H17F3N2O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is [7-(methylaminomethyl)-5-[4-(trifluoromethoxy)phenyl]quinolin-8-yl]methanol.
| Compound Name | [7-(methylaminomethyl)-5-[4-(trifluoromethoxy)phenyl]quinolin-8-yl]methanol |
|---|---|
| PubChem CID | 168905566 |
| Molecular Formula | C19H17F3N2O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | [7-(methylaminomethyl)-5-[4-(trifluoromethoxy)phenyl]quinolin-8-yl]methanol |
| SMILES | CNCc1cc(-c2ccc(OC(F)(F)F)cc2)c2cccnc2c1CO |
| InChI | InChI=1S/C19H17F3N2O2/c1-23-10-13-9-16(15-3-2-8-24-18(15)17(13)11-25)12-4-6-14(7-5-12)26-19(20,21)22/h2-9,23,25H,10-11H2,1H3 |
| InChIKey | CXIFVRCYFFGDAB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |