C21H21F3N4O4S — CID 174081635
tert-butyl N-[[7-(N'-hydroxycarbamimidoyl)-4-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazol-6-yl]methyl]carbamate (PubChem CID 174081635) has the molecular formula C21H21F3N4O4S and a molecular weight of 482.48 g/mol. Its IUPAC name is tert-butyl N-[[7-(N'-hydroxycarbamimidoyl)-4-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazol-6-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[7-(N'-hydroxycarbamimidoyl)-4-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazol-6-yl]methyl]carbamate |
|---|---|
| PubChem CID | 174081635 |
| Molecular Formula | C21H21F3N4O4S |
| Molecular Weight | 482.48 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | tert-butyl N-[[7-(N'-hydroxycarbamimidoyl)-4-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazol-6-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCc1cc(-c2ccc(OC(F)(F)F)cc2)c2ncsc2c1C(N)=NO |
| InChI | InChI=1S/C21H21F3N4O4S/c1-20(2,3)32-19(29)26-9-12-8-14(11-4-6-13(7-5-11)31-21(22,23)24)16-17(33-10-27-16)15(12)18(25)28-30/h4-8,10,30H,9H2,1-3H3,(H2,25,28)(H,26,29) |
| InChIKey | XDPJLNLEOYDFQP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 119.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.48 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|