C20H17F3N2O2 — CID 168905481
N-[[2-cyano-3-ethyl-5-[4-(trifluoromethoxy)phenyl]phenyl]methyl]prop-2-enamide (PubChem CID 168905481) has the molecular formula C20H17F3N2O2 and a molecular weight of 374.36 g/mol. Its IUPAC name is N-[[2-cyano-3-ethyl-5-[4-(trifluoromethoxy)phenyl]phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[2-cyano-3-ethyl-5-[4-(trifluoromethoxy)phenyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 168905481 |
| Molecular Formula | C20H17F3N2O2 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | N-[[2-cyano-3-ethyl-5-[4-(trifluoromethoxy)phenyl]phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cc(-c2ccc(OC(F)(F)F)cc2)cc(CC)c1C#N |
| InChI | InChI=1S/C20H17F3N2O2/c1-3-13-9-15(10-16(18(13)11-24)12-25-19(26)4-2)14-5-7-17(8-6-14)27-20(21,22)23/h4-10H,2-3,12H2,1H3,(H,25,26) |
| InChIKey | ZYPIUKBJVWGUQL-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|