C19H15F3N4O3 — CID 168905033
2-[(prop-2-enoylamino)methyl]-7-[4-(trifluoromethoxy)phenyl]-1H-benzimidazole-4-carboxamide (PubChem CID 168905033) has the molecular formula C19H15F3N4O3 and a molecular weight of 404.35 g/mol. Its IUPAC name is 2-[(prop-2-enoylamino)methyl]-7-[4-(trifluoromethoxy)phenyl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-[(prop-2-enoylamino)methyl]-7-[4-(trifluoromethoxy)phenyl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 168905033 |
| Molecular Formula | C19H15F3N4O3 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-[(prop-2-enoylamino)methyl]-7-[4-(trifluoromethoxy)phenyl]-1H-benzimidazole-4-carboxamide |
| SMILES | C=CC(=O)NCc1nc2c(C(N)=O)ccc(-c3ccc(OC(F)(F)F)cc3)c2[nH]1 |
| InChI | InChI=1S/C19H15F3N4O3/c1-2-15(27)24-9-14-25-16-12(7-8-13(18(23)28)17(16)26-14)10-3-5-11(6-4-10)29-19(20,21)22/h2-8H,1,9H2,(H2,23,28)(H,24,27)(H,25,26) |
| InChIKey | UKYGTIVEBDZNCX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|