C19H13F4N3O2 — CID 168825639
N-[[7-fluoro-4-[4-(trifluoromethoxy)phenyl]quinazolin-2-yl]methyl]prop-2-enamide (PubChem CID 168825639) has the molecular formula C19H13F4N3O2 and a molecular weight of 391.32 g/mol. Its IUPAC name is N-[[7-fluoro-4-[4-(trifluoromethoxy)phenyl]quinazolin-2-yl]methyl]prop-2-enamide.
| Compound Name | N-[[7-fluoro-4-[4-(trifluoromethoxy)phenyl]quinazolin-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 168825639 |
| Molecular Formula | C19H13F4N3O2 |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | N-[[7-fluoro-4-[4-(trifluoromethoxy)phenyl]quinazolin-2-yl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1nc(-c2ccc(OC(F)(F)F)cc2)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C19H13F4N3O2/c1-2-17(27)24-10-16-25-15-9-12(20)5-8-14(15)18(26-16)11-3-6-13(7-4-11)28-19(21,22)23/h2-9H,1,10H2,(H,24,27) |
| InChIKey | JZIPYJQTVKJHBW-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|