C25H32F4N2O3 — CID 168904692
N-[[3-[1-fluoroethyl(methyl)amino]-2-(hydroxymethyl)-4-methyl-5-[4-(trifluoromethoxy)phenyl]phenyl]methyl]prop-2-enamide;propane (PubChem CID 168904692) has the molecular formula C25H32F4N2O3 and a molecular weight of 484.53 g/mol. Its IUPAC name is N-[[3-[1-fluoroethyl(methyl)amino]-2-(hydroxymethyl)-4-methyl-5-[4-(trifluoromethoxy)phenyl]phenyl]methyl]prop-2-enamide;propane.
| Compound Name | N-[[3-[1-fluoroethyl(methyl)amino]-2-(hydroxymethyl)-4-methyl-5-[4-(trifluoromethoxy)phenyl]phenyl]methyl]prop-2-enamide;propane |
|---|---|
| PubChem CID | 168904692 |
| Molecular Formula | C25H32F4N2O3 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | N-[[3-[1-fluoroethyl(methyl)amino]-2-(hydroxymethyl)-4-methyl-5-[4-(trifluoromethoxy)phenyl]phenyl]methyl]prop-2-enamide;propane |
| SMILES | C=CC(=O)NCc1cc(-c2ccc(OC(F)(F)F)cc2)c(C)c(N(C)C(C)F)c1CO.CCC |
| InChI | InChI=1S/C22H24F4N2O3.C3H8/c1-5-20(30)27-11-16-10-18(13(2)21(19(16)12-29)28(4)14(3)23)15-6-8-17(9-7-15)31-22(24,25)26;1-3-2/h5-10,14,29H,1,11-12H2,2-4H3,(H,27,30);3H2,1-2H3 |
| InChIKey | FPXAMKXEVBTLLA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|