C25H25F5N2O3 — CID 168905187
N-[[3-[but-2-ynyl(difluoromethyl)amino]-2-(2-hydroxyethyl)-4-methyl-5-[4-(trifluoromethoxy)phenyl]phenyl]methyl]prop-2-enamide (PubChem CID 168905187) has the molecular formula C25H25F5N2O3 and a molecular weight of 496.48 g/mol. Its IUPAC name is N-[[3-[but-2-ynyl(difluoromethyl)amino]-2-(2-hydroxyethyl)-4-methyl-5-[4-(trifluoromethoxy)phenyl]phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[3-[but-2-ynyl(difluoromethyl)amino]-2-(2-hydroxyethyl)-4-methyl-5-[4-(trifluoromethoxy)phenyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 168905187 |
| Molecular Formula | C25H25F5N2O3 |
| Molecular Weight | 496.48 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | N-[[3-[but-2-ynyl(difluoromethyl)amino]-2-(2-hydroxyethyl)-4-methyl-5-[4-(trifluoromethoxy)phenyl]phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cc(-c2ccc(OC(F)(F)F)cc2)c(C)c(N(CC#CC)C(F)F)c1CCO |
| InChI | InChI=1S/C25H25F5N2O3/c1-4-6-12-32(24(26)27)23-16(3)21(17-7-9-19(10-8-17)35-25(28,29)30)14-18(20(23)11-13-33)15-31-22(34)5-2/h5,7-10,14,24,33H,2,11-13,15H2,1,3H3,(H,31,34) |
| InChIKey | FTVIJVGVOKQSOU-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.48 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|