C20H19BrF3NO — CID 168904688
2-bromo-3-ethyl-N,6-dimethyl-N-prop-1-ynyl-5-[4-(trifluoromethoxy)phenyl]aniline (PubChem CID 168904688) has the molecular formula C20H19BrF3NO and a molecular weight of 426.28 g/mol. Its IUPAC name is 2-bromo-3-ethyl-N,6-dimethyl-N-prop-1-ynyl-5-[4-(trifluoromethoxy)phenyl]aniline.
| Compound Name | 2-bromo-3-ethyl-N,6-dimethyl-N-prop-1-ynyl-5-[4-(trifluoromethoxy)phenyl]aniline |
|---|---|
| PubChem CID | 168904688 |
| Molecular Formula | C20H19BrF3NO |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 2-bromo-3-ethyl-N,6-dimethyl-N-prop-1-ynyl-5-[4-(trifluoromethoxy)phenyl]aniline |
| SMILES | CC#CN(C)c1c(C)c(-c2ccc(OC(F)(F)F)cc2)cc(CC)c1Br |
| InChI | InChI=1S/C20H19BrF3NO/c1-5-11-25(4)19-13(3)17(12-14(6-2)18(19)21)15-7-9-16(10-8-15)26-20(22,23)24/h7-10,12H,6H2,1-4H3 |
| InChIKey | BZNYDZWULAYMCG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|