C22H21BrF3NO3 — CID 168905287
ethyl 2-bromo-3-[but-2-ynyl(methyl)amino]-4-methyl-5-[4-(trifluoromethoxy)phenyl]benzoate (PubChem CID 168905287) has the molecular formula C22H21BrF3NO3 and a molecular weight of 484.31 g/mol. Its IUPAC name is ethyl 2-bromo-3-[but-2-ynyl(methyl)amino]-4-methyl-5-[4-(trifluoromethoxy)phenyl]benzoate.
| Compound Name | ethyl 2-bromo-3-[but-2-ynyl(methyl)amino]-4-methyl-5-[4-(trifluoromethoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 168905287 |
| Molecular Formula | C22H21BrF3NO3 |
| Molecular Weight | 484.31 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | ethyl 2-bromo-3-[but-2-ynyl(methyl)amino]-4-methyl-5-[4-(trifluoromethoxy)phenyl]benzoate |
| SMILES | CC#CCN(C)c1c(C)c(-c2ccc(OC(F)(F)F)cc2)cc(C(=O)OCC)c1Br |
| InChI | InChI=1S/C22H21BrF3NO3/c1-5-7-12-27(4)20-14(3)17(13-18(19(20)23)21(28)29-6-2)15-8-10-16(11-9-15)30-22(24,25)26/h8-11,13H,6,12H2,1-4H3 |
| InChIKey | DFRKGJFCYLLFFF-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.31 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|