C21H19BrF3NO3 — CID 168904768
ethyl 2-bromo-4-methyl-3-[methyl(prop-1-ynyl)amino]-5-[4-(trifluoromethoxy)phenyl]benzoate (PubChem CID 168904768) has the molecular formula C21H19BrF3NO3 and a molecular weight of 470.29 g/mol. Its IUPAC name is ethyl 2-bromo-4-methyl-3-[methyl(prop-1-ynyl)amino]-5-[4-(trifluoromethoxy)phenyl]benzoate.
| Compound Name | ethyl 2-bromo-4-methyl-3-[methyl(prop-1-ynyl)amino]-5-[4-(trifluoromethoxy)phenyl]benzoate |
|---|---|
| PubChem CID | 168904768 |
| Molecular Formula | C21H19BrF3NO3 |
| Molecular Weight | 470.29 g/mol |
| Exact Mass | 469.05 |
| IUPAC Name | ethyl 2-bromo-4-methyl-3-[methyl(prop-1-ynyl)amino]-5-[4-(trifluoromethoxy)phenyl]benzoate |
| SMILES | CC#CN(C)c1c(C)c(-c2ccc(OC(F)(F)F)cc2)cc(C(=O)OCC)c1Br |
| InChI | InChI=1S/C21H19BrF3NO3/c1-5-11-26(4)19-13(3)16(12-17(18(19)22)20(27)28-6-2)14-7-9-15(10-8-14)29-21(23,24)25/h7-10,12H,6H2,1-4H3 |
| InChIKey | RVHBXORFTWCDJA-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.29 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|