C25H31F5N2O3 — CID 168905180
1-[2-[but-1-ynyl(difluoromethyl)amino]-3-methyl-6-(methylaminomethyl)-4-[4-(trifluoromethoxy)phenyl]phenyl]ethane-1,2-diol;ethane (PubChem CID 168905180) has the molecular formula C25H31F5N2O3 and a molecular weight of 502.52 g/mol. Its IUPAC name is 1-[2-[but-1-ynyl(difluoromethyl)amino]-3-methyl-6-(methylaminomethyl)-4-[4-(trifluoromethoxy)phenyl]phenyl]ethane-1,2-diol;ethane.
| Compound Name | 1-[2-[but-1-ynyl(difluoromethyl)amino]-3-methyl-6-(methylaminomethyl)-4-[4-(trifluoromethoxy)phenyl]phenyl]ethane-1,2-diol;ethane |
|---|---|
| PubChem CID | 168905180 |
| Molecular Formula | C25H31F5N2O3 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.23 |
| IUPAC Name | 1-[2-[but-1-ynyl(difluoromethyl)amino]-3-methyl-6-(methylaminomethyl)-4-[4-(trifluoromethoxy)phenyl]phenyl]ethane-1,2-diol;ethane |
| SMILES | CC.CCC#CN(c1c(C)c(-c2ccc(OC(F)(F)F)cc2)cc(CNC)c1C(O)CO)C(F)F |
| InChI | InChI=1S/C23H25F5N2O3.C2H6/c1-4-5-10-30(22(24)25)21-14(2)18(11-16(12-29-3)20(21)19(32)13-31)15-6-8-17(9-7-15)33-23(26,27)28;1-2/h6-9,11,19,22,29,31-32H,4,12-13H2,1-3H3;1-2H3 |
| InChIKey | PPMAMHIELZCUQT-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|