C23H19F4N3O2 — CID 168905293
N-[[2-cyano-5-[2-fluoro-4-(trifluoromethoxy)phenyl]-4-methyl-3-[methyl(prop-1-ynyl)amino]phenyl]methyl]prop-2-enamide (PubChem CID 168905293) has the molecular formula C23H19F4N3O2 and a molecular weight of 445.42 g/mol. Its IUPAC name is N-[[2-cyano-5-[2-fluoro-4-(trifluoromethoxy)phenyl]-4-methyl-3-[methyl(prop-1-ynyl)amino]phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[2-cyano-5-[2-fluoro-4-(trifluoromethoxy)phenyl]-4-methyl-3-[methyl(prop-1-ynyl)amino]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 168905293 |
| Molecular Formula | C23H19F4N3O2 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | N-[[2-cyano-5-[2-fluoro-4-(trifluoromethoxy)phenyl]-4-methyl-3-[methyl(prop-1-ynyl)amino]phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cc(-c2ccc(OC(F)(F)F)cc2F)c(C)c(N(C)C#CC)c1C#N |
| InChI | InChI=1S/C23H19F4N3O2/c1-5-9-30(4)22-14(3)18(10-15(19(22)12-28)13-29-21(31)6-2)17-8-7-16(11-20(17)24)32-23(25,26)27/h6-8,10-11H,2,13H2,1,3-4H3,(H,29,31) |
| InChIKey | NYNWBYCXEMHNIP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|