C42H37IrN3O-2 — CID 168827930
8-(4-cyclohexyl-5-methyl-2-pyridinyl)-2-(2,6-dimethylphenyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;2-phenylpyridine (PubChem CID 168827930) has the molecular formula C42H37IrN3O-2 and a molecular weight of 792.00 g/mol. Its IUPAC name is 8-(4-cyclohexyl-5-methyl-2-pyridinyl)-2-(2,6-dimethylphenyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;2-phenylpyridine.
| Compound Name | 8-(4-cyclohexyl-5-methyl-2-pyridinyl)-2-(2,6-dimethylphenyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 168827930 |
| Molecular Formula | C42H37IrN3O-2 |
| Molecular Weight | 792.00 g/mol |
| Exact Mass | 792.26 |
| IUPAC Name | 8-(4-cyclohexyl-5-methyl-2-pyridinyl)-2-(2,6-dimethylphenyl)-7H-[1]benzofuro[2,3-b]pyridin-7-ide;iridium;2-phenylpyridine |
| SMILES | Cc1cnc(-c2[c-]ccc3c2oc2nc(-c4c(C)cccc4C)ccc23)cc1C1CCCCC1.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C31H29N2O.C11H8N.Ir/c1-19-9-7-10-20(2)29(19)27-16-15-24-23-13-8-14-25(30(23)34-31(24)33-27)28-17-26(21(3)18-32-28)22-11-5-4-6-12-22;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h7-10,13,15-18,22H,4-6,11-12H2,1-3H3;1-6,8-9H;/q2*-1; |
| InChIKey | UEXWNDMYNCKJMO-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.00 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|