C36H30IrN2OS-2 — CID 168829683
2-(8H-[1]benzothiolo[4,5-b][1]benzofuran-8-id-9-yl)-4-(3,3-dimethylbutan-2-yl)pyridine;iridium;2-phenylpyridine (PubChem CID 168829683) has the molecular formula C36H30IrN2OS-2 and a molecular weight of 730.93 g/mol. Its IUPAC name is 2-(8H-[1]benzothiolo[4,5-b][1]benzofuran-8-id-9-yl)-4-(3,3-dimethylbutan-2-yl)pyridine;iridium;2-phenylpyridine.
| Compound Name | 2-(8H-[1]benzothiolo[4,5-b][1]benzofuran-8-id-9-yl)-4-(3,3-dimethylbutan-2-yl)pyridine;iridium;2-phenylpyridine |
|---|---|
| PubChem CID | 168829683 |
| Molecular Formula | C36H30IrN2OS-2 |
| Molecular Weight | 730.93 g/mol |
| Exact Mass | 731.17 |
| IUPAC Name | 2-(8H-[1]benzothiolo[4,5-b][1]benzofuran-8-id-9-yl)-4-(3,3-dimethylbutan-2-yl)pyridine;iridium;2-phenylpyridine |
| SMILES | CC(c1ccnc(-c2[c-]ccc3c2oc2c4ccsc4ccc32)c1)C(C)(C)C.[Ir].[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C25H22NOS.C11H8N.Ir/c1-15(25(2,3)4)16-10-12-26-21(14-16)19-7-5-6-17-18-8-9-22-20(11-13-28-22)24(18)27-23(17)19;1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h5-6,8-15H,1-4H3;1-6,8-9H;/q2*-1; |
| InChIKey | KJELXHFREJFFHJ-UHFFFAOYSA-N |
| XLogP | 10.36 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.93 |
| LogP ≤ 5 | 10.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|