C63H49N3OSi — CID 168834665
2-(4-dibenzofuran-3-ylphenyl)-4-[3-(5',5'-dimethylspiro[adamantane-2,12'-fluoreno[2,1-b][1]benzosilole]-7'-yl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 168834665) has the molecular formula C63H49N3OSi and a molecular weight of 892.19 g/mol. Its IUPAC name is 2-(4-dibenzofuran-3-ylphenyl)-4-[3-(5',5'-dimethylspiro[adamantane-2,12'-fluoreno[2,1-b][1]benzosilole]-7'-yl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(4-dibenzofuran-3-ylphenyl)-4-[3-(5',5'-dimethylspiro[adamantane-2,12'-fluoreno[2,1-b][1]benzosilole]-7'-yl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168834665 |
| Molecular Formula | C63H49N3OSi |
| Molecular Weight | 892.19 g/mol |
| Exact Mass | 891.36 |
| IUPAC Name | 2-(4-dibenzofuran-3-ylphenyl)-4-[3-(5',5'-dimethylspiro[adamantane-2,12'-fluoreno[2,1-b][1]benzosilole]-7'-yl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | C[Si]1(C)c2ccccc2-c2c1cc(-c1cccc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5ccc6c(c5)oc5ccccc56)cc4)n3)c1)c1c2C2(c3ccccc3-1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C63H49N3OSi/c1-68(2)55-22-11-8-19-50(55)58-56(68)36-51(57-49-18-6-9-20-52(49)63(59(57)58)45-30-37-29-38(32-45)33-46(63)31-37)43-15-12-16-44(34-43)62-65-60(40-13-4-3-5-14-40)64-61(66-62)41-25-23-39(24-26-41)42-27-28-48-47-17-7-10-21-53(47)67-54(48)35-42/h3-28,34-38,45-46H,29-33H2,1-2H3 |
| InChIKey | MTVHSDYMNGQGHI-UHFFFAOYSA-N |
| XLogP | 14.63 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.19 |
| LogP ≤ 5 | 14.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|