C50H38N2OS — CID 168834770
4-phenyl-6-(3-phenylphenyl)-2-spiro[adamantane-2,8'-indeno[1,2-a]phenoxathiine]-10'-ylpyrimidine (PubChem CID 168834770) has the molecular formula C50H38N2OS and a molecular weight of 714.93 g/mol. Its IUPAC name is 4-phenyl-6-(3-phenylphenyl)-2-spiro[adamantane-2,8'-indeno[1,2-a]phenoxathiine]-10'-ylpyrimidine.
| Compound Name | 4-phenyl-6-(3-phenylphenyl)-2-spiro[adamantane-2,8'-indeno[1,2-a]phenoxathiine]-10'-ylpyrimidine |
|---|---|
| PubChem CID | 168834770 |
| Molecular Formula | C50H38N2OS |
| Molecular Weight | 714.93 g/mol |
| Exact Mass | 714.27 |
| IUPAC Name | 4-phenyl-6-(3-phenylphenyl)-2-spiro[adamantane-2,8'-indeno[1,2-a]phenoxathiine]-10'-ylpyrimidine |
| SMILES | c1ccc(-c2cccc(-c3cc(-c4ccccc4)nc(-c4ccc5c(c4)C4(c6ccc7c(c6-5)Sc5ccccc5O7)C5CC6CC(C5)CC4C6)n3)c2)cc1 |
| InChI | InChI=1S/C50H38N2OS/c1-3-10-32(11-4-1)34-14-9-15-35(27-34)43-29-42(33-12-5-2-6-13-33)51-49(52-43)36-18-19-39-41(28-36)50(37-23-30-22-31(25-37)26-38(50)24-30)40-20-21-45-48(47(39)40)54-46-17-8-7-16-44(46)53-45/h1-21,27-31,37-38H,22-26H2 |
| InChIKey | KXFWXHSXJYBHKF-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.93 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |