C28H22N6O — CID 168838841
2-[3-[(6-isocyano-5,6,7,8-tetrahydroquinolin-4-yl)amino]phenyl]-N-pyridin-4-yl-1,3-benzoxazol-6-amine (PubChem CID 168838841) has the molecular formula C28H22N6O and a molecular weight of 458.53 g/mol. Its IUPAC name is 2-[3-[(6-isocyano-5,6,7,8-tetrahydroquinolin-4-yl)amino]phenyl]-N-pyridin-4-yl-1,3-benzoxazol-6-amine.
| Compound Name | 2-[3-[(6-isocyano-5,6,7,8-tetrahydroquinolin-4-yl)amino]phenyl]-N-pyridin-4-yl-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 168838841 |
| Molecular Formula | C28H22N6O |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 2-[3-[(6-isocyano-5,6,7,8-tetrahydroquinolin-4-yl)amino]phenyl]-N-pyridin-4-yl-1,3-benzoxazol-6-amine |
| SMILES | [C-]#[N+]C1CCc2nccc(Nc3cccc(-c4nc5ccc(Nc6ccncc6)cc5o4)c3)c2C1 |
| InChI | InChI=1S/C28H22N6O/c1-29-20-5-7-24-23(16-20)25(11-14-31-24)33-21-4-2-3-18(15-21)28-34-26-8-6-22(17-27(26)35-28)32-19-9-12-30-13-10-19/h2-4,6,8-15,17,20H,5,7,16H2,(H,30,32)(H,31,33) |
| InChIKey | KMNPRHMXHUQVEL-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|