C12H14ClF3N2O2 — CID 168844177
ethyl 2-amino-3-[2-chloro-4-methyl-6-(trifluoromethyl)-3-pyridinyl]propanoate (PubChem CID 168844177) has the molecular formula C12H14ClF3N2O2 and a molecular weight of 310.70 g/mol. Its IUPAC name is ethyl 2-amino-3-[2-chloro-4-methyl-6-(trifluoromethyl)-3-pyridinyl]propanoate.
| Compound Name | ethyl 2-amino-3-[2-chloro-4-methyl-6-(trifluoromethyl)-3-pyridinyl]propanoate |
|---|---|
| PubChem CID | 168844177 |
| Molecular Formula | C12H14ClF3N2O2 |
| Molecular Weight | 310.70 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | ethyl 2-amino-3-[2-chloro-4-methyl-6-(trifluoromethyl)-3-pyridinyl]propanoate |
| SMILES | CCOC(=O)C(N)Cc1c(C)cc(C(F)(F)F)nc1Cl |
| InChI | InChI=1S/C12H14ClF3N2O2/c1-3-20-11(19)8(17)5-7-6(2)4-9(12(14,15)16)18-10(7)13/h4,8H,3,5,17H2,1-2H3 |
| InChIKey | HMZXRNKQHMKXJZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.70 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|