C19H28O2 — CID 168849685
(11S,13S,17S)-2,2,4,6,6,10-hexadeuterio-17-hydroxy-11,13-dimethyl-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 168849685) has the molecular formula C19H28O2 and a molecular weight of 294.47 g/mol. Its IUPAC name is (11S,13S,17S)-2,2,4,6,6,10-hexadeuterio-17-hydroxy-11,13-dimethyl-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (11S,13S,17S)-2,2,4,6,6,10-hexadeuterio-17-hydroxy-11,13-dimethyl-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 168849685 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 294.47 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | (11S,13S,17S)-2,2,4,6,6,10-hexadeuterio-17-hydroxy-11,13-dimethyl-1,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | [2H]C1=C2C([2H])([2H])CC3C(C(C)C[C@@]4(C)C3CC[C@@H]4O)C2([2H])CC([2H])([2H])C1=O |
| InChI | InChI=1S/C19H28O2/c1-11-10-19(2)16(7-8-17(19)21)15-5-3-12-9-13(20)4-6-14(12)18(11)15/h9,11,14-18,21H,3-8,10H2,1-2H3/t11?,14?,15?,16?,17-,18?,19-/m0/s1/i3D2,4D2,9D,14D |
| InChIKey | QCNNHARIRLYUAB-BVHNGXGZSA-N |
| XLogP | 3.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |