C26H18FNO3 — CID 168854384
2-[(3Z)-6-fluoro-3-[[4-(3-isocyanophenoxy)phenyl]methylidene]-2-methylinden-1-yl]acetic acid (PubChem CID 168854384) has the molecular formula C26H18FNO3 and a molecular weight of 411.43 g/mol. Its IUPAC name is 2-[(3Z)-6-fluoro-3-[[4-(3-isocyanophenoxy)phenyl]methylidene]-2-methylinden-1-yl]acetic acid.
| Compound Name | 2-[(3Z)-6-fluoro-3-[[4-(3-isocyanophenoxy)phenyl]methylidene]-2-methylinden-1-yl]acetic acid |
|---|---|
| PubChem CID | 168854384 |
| Molecular Formula | C26H18FNO3 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 2-[(3Z)-6-fluoro-3-[[4-(3-isocyanophenoxy)phenyl]methylidene]-2-methylinden-1-yl]acetic acid |
| SMILES | [C-]#[N+]c1cccc(Oc2ccc(/C=C3/C(C)=C(CC(=O)O)c4cc(F)ccc43)cc2)c1 |
| InChI | InChI=1S/C26H18FNO3/c1-16-23(22-11-8-18(27)13-25(22)24(16)15-26(29)30)12-17-6-9-20(10-7-17)31-21-5-3-4-19(14-21)28-2/h3-14H,15H2,1H3,(H,29,30)/b23-12- |
| InChIKey | FMUWFGPHCOGTTF-FMCGGJTJSA-N |
| XLogP | 6.97 |
| TPSA | 50.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|