C24H20F3NO4 — CID 170432238
3-(3-methoxyphenyl)imino-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]butanoic acid (PubChem CID 170432238) has the molecular formula C24H20F3NO4 and a molecular weight of 443.42 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)imino-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]butanoic acid.
| Compound Name | 3-(3-methoxyphenyl)imino-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]butanoic acid |
|---|---|
| PubChem CID | 170432238 |
| Molecular Formula | C24H20F3NO4 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 3-(3-methoxyphenyl)imino-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]butanoic acid |
| SMILES | COc1cccc(/N=C(\C)C(C(=O)O)c2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)c1 |
| InChI | InChI=1S/C24H20F3NO4/c1-15(28-19-4-3-5-21(14-19)31-2)22(23(29)30)18-8-6-16(7-9-18)17-10-12-20(13-11-17)32-24(25,26)27/h3-14,22H,1-2H3,(H,29,30)/b28-15+ |
| InChIKey | GLVCHYCDGDDNMB-RWPZCVJISA-N |
| XLogP | 6.22 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|