C26H23F4NO4 — CID 123509551
ethyl 3-(3-fluoro-4-methoxyphenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate (PubChem CID 123509551) has the molecular formula C26H23F4NO4 and a molecular weight of 489.47 g/mol. Its IUPAC name is ethyl 3-(3-fluoro-4-methoxyphenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate.
| Compound Name | ethyl 3-(3-fluoro-4-methoxyphenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 123509551 |
| Molecular Formula | C26H23F4NO4 |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | ethyl 3-(3-fluoro-4-methoxyphenyl)imino-3-[4-[[4-(trifluoromethoxy)phenyl]methyl]phenyl]propanoate |
| SMILES | CCOC(=O)C/C(=N\c1ccc(OC)c(F)c1)c1ccc(Cc2ccc(OC(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H23F4NO4/c1-3-34-25(32)16-23(31-20-10-13-24(33-2)22(27)15-20)19-8-4-17(5-9-19)14-18-6-11-21(12-7-18)35-26(28,29)30/h4-13,15H,3,14,16H2,1-2H3/b31-23+ |
| InChIKey | QHQAAAIDEFVHAH-UQRQXUALSA-N |
| XLogP | 6.40 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|