C25H31NO4 — CID 90868326
ethyl 2-[N-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]-C-(4-methoxyphenyl)carbonimidoyl]butanoate (PubChem CID 90868326) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is ethyl 2-[N-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]-C-(4-methoxyphenyl)carbonimidoyl]butanoate.
| Compound Name | ethyl 2-[N-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]-C-(4-methoxyphenyl)carbonimidoyl]butanoate |
|---|---|
| PubChem CID | 90868326 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | ethyl 2-[N-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]-C-(4-methoxyphenyl)carbonimidoyl]butanoate |
| SMILES | CCOC(=O)C(CC)/C(=N\c1cccc(O)c1CC=C(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C25H31NO4/c1-6-20(25(28)30-7-2)24(18-12-14-19(29-5)15-13-18)26-22-9-8-10-23(27)21(22)16-11-17(3)4/h8-15,20,27H,6-7,16H2,1-5H3/b26-24- |
| InChIKey | TUMUGCJBBKHUPH-LCUIJRPUSA-N |
| XLogP | 5.62 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|