C18H19NO4 — CID 91480129
ethyl 3-(4-hydroxyphenyl)imino-2-(4-methoxyphenyl)propanoate (PubChem CID 91480129) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is ethyl 3-(4-hydroxyphenyl)imino-2-(4-methoxyphenyl)propanoate.
| Compound Name | ethyl 3-(4-hydroxyphenyl)imino-2-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 91480129 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | ethyl 3-(4-hydroxyphenyl)imino-2-(4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C(/C=N/c1ccc(O)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H19NO4/c1-3-23-18(21)17(13-4-10-16(22-2)11-5-13)12-19-14-6-8-15(20)9-7-14/h4-12,17,20H,3H2,1-2H3/b19-12+ |
| InChIKey | IFQXGAWWFPTRSU-XDHOZWIPSA-N |
| XLogP | 3.45 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|