C23H27NO4 — CID 91333130
ethyl 3-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]imino-3-(4-methoxyphenyl)propanoate (PubChem CID 91333130) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is ethyl 3-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]imino-3-(4-methoxyphenyl)propanoate.
| Compound Name | ethyl 3-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]imino-3-(4-methoxyphenyl)propanoate |
|---|---|
| PubChem CID | 91333130 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | ethyl 3-[3-hydroxy-2-(3-methylbut-2-enyl)phenyl]imino-3-(4-methoxyphenyl)propanoate |
| SMILES | CCOC(=O)C/C(=N\c1cccc(O)c1CC=C(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H27NO4/c1-5-28-23(26)15-21(17-10-12-18(27-4)13-11-17)24-20-7-6-8-22(25)19(20)14-9-16(2)3/h6-13,25H,5,14-15H2,1-4H3/b24-21+ |
| InChIKey | WMPUWGBODNGAPT-DARPEHSRSA-N |
| XLogP | 4.98 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|