C28H23Cl2N5O4S — CID 168854643
2-(2,4-dichlorophenyl)-5-methoxy-N-(2,2,3,3,5,5,6,6-octadeuterio-1,1-dioxo-1,4-thiazinan-4-yl)-1-[4-(2-pyridin-3-ylethynyl)phenyl]imidazole-4-carboxamide (PubChem CID 168854643) has the molecular formula C28H23Cl2N5O4S and a molecular weight of 604.54 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-5-methoxy-N-(2,2,3,3,5,5,6,6-octadeuterio-1,1-dioxo-1,4-thiazinan-4-yl)-1-[4-(2-pyridin-3-ylethynyl)phenyl]imidazole-4-carboxamide.
| Compound Name | 2-(2,4-dichlorophenyl)-5-methoxy-N-(2,2,3,3,5,5,6,6-octadeuterio-1,1-dioxo-1,4-thiazinan-4-yl)-1-[4-(2-pyridin-3-ylethynyl)phenyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 168854643 |
| Molecular Formula | C28H23Cl2N5O4S |
| Molecular Weight | 604.54 g/mol |
| Exact Mass | 603.13 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-5-methoxy-N-(2,2,3,3,5,5,6,6-octadeuterio-1,1-dioxo-1,4-thiazinan-4-yl)-1-[4-(2-pyridin-3-ylethynyl)phenyl]imidazole-4-carboxamide |
| SMILES | [2H]C1([2H])N(NC(=O)c2nc(-c3ccc(Cl)cc3Cl)n(-c3ccc(C#Cc4cccnc4)cc3)c2OC)C([2H])([2H])C([2H])([2H])S(=O)(=O)C1([2H])[2H] |
| InChI | InChI=1S/C28H23Cl2N5O4S/c1-39-28-25(27(36)33-34-13-15-40(37,38)16-14-34)32-26(23-11-8-21(29)17-24(23)30)35(28)22-9-6-19(7-10-22)4-5-20-3-2-12-31-18-20/h2-3,6-12,17-18H,13-16H2,1H3,(H,33,36)/i13D2,14D2,15D2,16D2 |
| InChIKey | IUAYESCAGDQJAJ-DBVREXLBSA-N |
| XLogP | 4.02 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|