C25H23Cl2N5O6S — CID 168854668
4-[4-[2-(2,4-dichlorophenyl)-5-methyl-4-[(2,2,3,3,5,5,6,6-octadeuterio-1,1-dioxo-1,4-thiazinan-4-yl)carbamoyl]imidazol-1-yl]phenyl]but-3-ynyl nitrate (PubChem CID 168854668) has the molecular formula C25H23Cl2N5O6S and a molecular weight of 600.51 g/mol. Its IUPAC name is 4-[4-[2-(2,4-dichlorophenyl)-5-methyl-4-[(2,2,3,3,5,5,6,6-octadeuterio-1,1-dioxo-1,4-thiazinan-4-yl)carbamoyl]imidazol-1-yl]phenyl]but-3-ynyl nitrate.
| Compound Name | 4-[4-[2-(2,4-dichlorophenyl)-5-methyl-4-[(2,2,3,3,5,5,6,6-octadeuterio-1,1-dioxo-1,4-thiazinan-4-yl)carbamoyl]imidazol-1-yl]phenyl]but-3-ynyl nitrate |
|---|---|
| PubChem CID | 168854668 |
| Molecular Formula | C25H23Cl2N5O6S |
| Molecular Weight | 600.51 g/mol |
| Exact Mass | 599.12 |
| IUPAC Name | 4-[4-[2-(2,4-dichlorophenyl)-5-methyl-4-[(2,2,3,3,5,5,6,6-octadeuterio-1,1-dioxo-1,4-thiazinan-4-yl)carbamoyl]imidazol-1-yl]phenyl]but-3-ynyl nitrate |
| SMILES | [2H]C1([2H])N(NC(=O)c2nc(-c3ccc(Cl)cc3Cl)n(-c3ccc(C#CCCO[N+](=O)[O-])cc3)c2C)C([2H])([2H])C([2H])([2H])S(=O)(=O)C1([2H])[2H] |
| InChI | InChI=1S/C25H23Cl2N5O6S/c1-17-23(25(33)29-30-11-14-39(36,37)15-12-30)28-24(21-10-7-19(26)16-22(21)27)31(17)20-8-5-18(6-9-20)4-2-3-13-38-32(34)35/h5-10,16H,3,11-15H2,1H3,(H,29,33)/i11D2,12D2,14D2,15D2 |
| InChIKey | AHADDPSKGFUOCH-WIOWLWTCSA-N |
| XLogP | 3.48 |
| TPSA | 136.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|