C48H38N5O2Pt-3 — CID 168857722
CID 168857722 (PubChem CID 168857722) has the molecular formula C48H38N5O2Pt-3 and a molecular weight of 911.94 g/mol.
| Compound Name | CID 168857722 |
|---|---|
| PubChem CID | 168857722 |
| Molecular Formula | C48H38N5O2Pt-3 |
| Molecular Weight | 911.94 g/mol |
| Exact Mass | 911.27 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(N5[CH-]N(c6ccccc6C(C)(C)C)c6ccccc65)ccc4)ccc3c3oc4ccc5ccccc5c4c32)c1.[Pt] |
| InChI | InChI=1S/C48H38N5O2.Pt/c1-48(2,3)38-17-8-9-18-39(38)52-30-51(40-19-10-11-20-41(40)52)33-14-12-15-34(27-33)54-35-22-23-37-42(29-35)53(44-28-32(50(4)5)25-26-49-44)46-45-36-16-7-6-13-31(36)21-24-43(45)55-47(37)46;/h6-26,28,30H,1-5H3;/q-3; |
| InChIKey | VUTXRDGTXCUNHL-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.94 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|