C14H17ClO — CID 168859026
[(4R)-2-(4-chlorophenyl)-4-methylcyclohexen-1-yl]methanol (PubChem CID 168859026) has the molecular formula C14H17ClO and a molecular weight of 236.74 g/mol. Its IUPAC name is [(4R)-2-(4-chlorophenyl)-4-methylcyclohexen-1-yl]methanol.
| Compound Name | [(4R)-2-(4-chlorophenyl)-4-methylcyclohexen-1-yl]methanol |
|---|---|
| PubChem CID | 168859026 |
| Molecular Formula | C14H17ClO |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | [(4R)-2-(4-chlorophenyl)-4-methylcyclohexen-1-yl]methanol |
| SMILES | C[C@@H]1CCC(CO)=C(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C14H17ClO/c1-10-2-3-12(9-16)14(8-10)11-4-6-13(15)7-5-11/h4-7,10,16H,2-3,8-9H2,1H3/t10-/m1/s1 |
| InChIKey | YLIHDOCVGFXXTB-SNVBAGLBSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |