C30H42N2O4S4 — CID 168859068
(3R,6S)-3,6-bis[[4-(3-sulfanylpropoxy)phenyl]methyl]-1,4-bis(3-sulfanylpropyl)piperazine-2,5-dione (PubChem CID 168859068) has the molecular formula C30H42N2O4S4 and a molecular weight of 622.94 g/mol. Its IUPAC name is (3R,6S)-3,6-bis[[4-(3-sulfanylpropoxy)phenyl]methyl]-1,4-bis(3-sulfanylpropyl)piperazine-2,5-dione.
| Compound Name | (3R,6S)-3,6-bis[[4-(3-sulfanylpropoxy)phenyl]methyl]-1,4-bis(3-sulfanylpropyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 168859068 |
| Molecular Formula | C30H42N2O4S4 |
| Molecular Weight | 622.94 g/mol |
| Exact Mass | 622.20 |
| IUPAC Name | (3R,6S)-3,6-bis[[4-(3-sulfanylpropoxy)phenyl]methyl]-1,4-bis(3-sulfanylpropyl)piperazine-2,5-dione |
| SMILES | O=C1[C@H](Cc2ccc(OCCCS)cc2)N(CCCS)C(=O)[C@@H](Cc2ccc(OCCCS)cc2)N1CCCS |
| InChI | InChI=1S/C30H42N2O4S4/c33-29-28(22-24-7-11-26(12-8-24)36-16-4-20-40)32(14-2-18-38)30(34)27(31(29)13-1-17-37)21-23-5-9-25(10-6-23)35-15-3-19-39/h5-12,27-28,37-40H,1-4,13-22H2/t27-,28+ |
| InChIKey | KSZBGJFQCAJSAS-HNRBIFIRSA-N |
| XLogP | 4.92 |
| TPSA | 59.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.94 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|