C19H18ClFN4O3 — CID 168859699
N-[[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-pyridazin-3-ylmethyl]bicyclo[1.1.1]pentane-1-carboxamide (PubChem CID 168859699) has the molecular formula C19H18ClFN4O3 and a molecular weight of 404.83 g/mol. Its IUPAC name is N-[[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-pyridazin-3-ylmethyl]bicyclo[1.1.1]pentane-1-carboxamide.
| Compound Name | N-[[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-pyridazin-3-ylmethyl]bicyclo[1.1.1]pentane-1-carboxamide |
|---|---|
| PubChem CID | 168859699 |
| Molecular Formula | C19H18ClFN4O3 |
| Molecular Weight | 404.83 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-[[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-pyridazin-3-ylmethyl]bicyclo[1.1.1]pentane-1-carboxamide |
| SMILES | O=C(COc1ccc(Cl)c(F)c1)NC(NC(=O)C12CC(C1)C2)c1cccnn1 |
| InChI | InChI=1S/C19H18ClFN4O3/c20-13-4-3-12(6-14(13)21)28-10-16(26)23-17(15-2-1-5-22-25-15)24-18(27)19-7-11(8-19)9-19/h1-6,11,17H,7-10H2,(H,23,26)(H,24,27) |
| InChIKey | TVYLROTZVYPMTB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.83 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|