About 1-chloro-5-iodopyrazole
1-chloro-5-iodopyrazole (PubChem CID 168861992) has the molecular formula C3H2ClIN2
and a molecular weight of 228.42 g/mol. Its IUPAC name is 1-chloro-5-iodopyrazole.
Molecular Properties
| Compound Name | 1-chloro-5-iodopyrazole |
| PubChem CID | 168861992 |
| Molecular Formula | C3H2ClIN2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 227.90 |
| IUPAC Name | 1-chloro-5-iodopyrazole |
| SMILES | Cln1nccc1I |
| InChI | InChI=1S/C3H2ClIN2/c4-7-3(5)1-2-6-7/h1-2H |
| InChIKey | YKQXQGCEBDXINK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-5-iodopyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-5-iodopyrazole?
The IUPAC name of 1-chloro-5-iodopyrazole (CID 168861992) is 1-chloro-5-iodopyrazole.
What is the SMILES notation for 1-chloro-5-iodopyrazole?
The canonical SMILES for 1-chloro-5-iodopyrazole is Cln1nccc1I.
What is the InChIKey of 1-chloro-5-iodopyrazole?
The InChIKey is YKQXQGCEBDXINK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2ClIN2/c4-7-3(5)1-2-6-7/h1-2H.
What are the key properties of 1-chloro-5-iodopyrazole?
1-chloro-5-iodopyrazole has a molecular weight of 228.42 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-5-iodopyrazole is sourced from PubChem (CID 168861992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).