C15H17N3O3S — CID 168863218
N-methyl-3-(2-methylpropyl)-N-(5-nitro-1,3-thiazol-2-yl)benzamide (PubChem CID 168863218) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-methyl-3-(2-methylpropyl)-N-(5-nitro-1,3-thiazol-2-yl)benzamide.
| Compound Name | N-methyl-3-(2-methylpropyl)-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 168863218 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-methyl-3-(2-methylpropyl)-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
| SMILES | CC(C)Cc1cccc(C(=O)N(C)c2ncc([N+](=O)[O-])s2)c1 |
| InChI | InChI=1S/C15H17N3O3S/c1-10(2)7-11-5-4-6-12(8-11)14(19)17(3)15-16-9-13(22-15)18(20)21/h4-6,8-10H,7H2,1-3H3 |
| InChIKey | HZZVJARIXYLDKB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 76.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|