C28H24F3NO3 — CID 168864607
(E)-3-[2,2-dimethyl-8-[3-(trifluoromethyl)phenyl]chromen-6-yl]-N-(4-methoxyphenyl)prop-2-enamide (PubChem CID 168864607) has the molecular formula C28H24F3NO3 and a molecular weight of 479.50 g/mol. Its IUPAC name is (E)-3-[2,2-dimethyl-8-[3-(trifluoromethyl)phenyl]chromen-6-yl]-N-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-3-[2,2-dimethyl-8-[3-(trifluoromethyl)phenyl]chromen-6-yl]-N-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 168864607 |
| Molecular Formula | C28H24F3NO3 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | (E)-3-[2,2-dimethyl-8-[3-(trifluoromethyl)phenyl]chromen-6-yl]-N-(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C=C/c2cc3c(c(-c4cccc(C(F)(F)F)c4)c2)OC(C)(C)C=C3)cc1 |
| InChI | InChI=1S/C28H24F3NO3/c1-27(2)14-13-20-15-18(7-12-25(33)32-22-8-10-23(34-3)11-9-22)16-24(26(20)35-27)19-5-4-6-21(17-19)28(29,30)31/h4-17H,1-3H3,(H,32,33)/b12-7+ |
| InChIKey | JJEIKMPIWKJXDQ-KPKJPENVSA-N |
| XLogP | 7.22 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|