C18H17N3O — CID 168865120
(E)-N-(2,6-dimethylphenyl)-3-(1H-indazol-6-yl)prop-2-enamide (PubChem CID 168865120) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is (E)-N-(2,6-dimethylphenyl)-3-(1H-indazol-6-yl)prop-2-enamide.
| Compound Name | (E)-N-(2,6-dimethylphenyl)-3-(1H-indazol-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 168865120 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | (E)-N-(2,6-dimethylphenyl)-3-(1H-indazol-6-yl)prop-2-enamide |
| SMILES | Cc1cccc(C)c1NC(=O)/C=C/c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C18H17N3O/c1-12-4-3-5-13(2)18(12)20-17(22)9-7-14-6-8-15-11-19-21-16(15)10-14/h3-11H,1-2H3,(H,19,21)(H,20,22)/b9-7+ |
| InChIKey | RTQULIXDOMDDOP-VQHVLOKHSA-N |
| XLogP | 3.83 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|