C25H27N3O2 — CID 168865126
N-(7-methyl-2,3-dihydro-1H-inden-1-yl)-3-[1-(oxan-2-yl)indazol-6-yl]prop-2-enamide (PubChem CID 168865126) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is N-(7-methyl-2,3-dihydro-1H-inden-1-yl)-3-[1-(oxan-2-yl)indazol-6-yl]prop-2-enamide.
| Compound Name | N-(7-methyl-2,3-dihydro-1H-inden-1-yl)-3-[1-(oxan-2-yl)indazol-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 168865126 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | N-(7-methyl-2,3-dihydro-1H-inden-1-yl)-3-[1-(oxan-2-yl)indazol-6-yl]prop-2-enamide |
| SMILES | Cc1cccc2c1C(NC(=O)C=Cc1ccc3cnn(C4CCCCO4)c3c1)CC2 |
| InChI | InChI=1S/C25H27N3O2/c1-17-5-4-6-19-11-12-21(25(17)19)27-23(29)13-9-18-8-10-20-16-26-28(22(20)15-18)24-7-2-3-14-30-24/h4-6,8-10,13,15-16,21,24H,2-3,7,11-12,14H2,1H3,(H,27,29) |
| InChIKey | NEXNSXXDMSQXKR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|