C29H22F5N5 — CID 168865951
4-[2-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridin-5-yl)-6-[2-fluoro-6-(trifluoromethyl)phenyl]quinazolin-4-yl]-2-fluorobenzonitrile (PubChem CID 168865951) has the molecular formula C29H22F5N5 and a molecular weight of 535.52 g/mol. Its IUPAC name is 4-[2-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridin-5-yl)-6-[2-fluoro-6-(trifluoromethyl)phenyl]quinazolin-4-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[2-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridin-5-yl)-6-[2-fluoro-6-(trifluoromethyl)phenyl]quinazolin-4-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 168865951 |
| Molecular Formula | C29H22F5N5 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 4-[2-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridin-5-yl)-6-[2-fluoro-6-(trifluoromethyl)phenyl]quinazolin-4-yl]-2-fluorobenzonitrile |
| SMILES | N#Cc1ccc(-c2nc(N3CCC4NCCC4C3)nc3ccc(-c4c(F)cccc4C(F)(F)F)cc23)cc1F |
| InChI | InChI=1S/C29H22F5N5/c30-22-3-1-2-21(29(32,33)34)26(22)16-6-7-25-20(12-16)27(17-4-5-18(14-35)23(31)13-17)38-28(37-25)39-11-9-24-19(15-39)8-10-36-24/h1-7,12-13,19,24,36H,8-11,15H2 |
| InChIKey | MTNYJCCISVJSBC-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |