C17H18N4 — CID 146040979
2-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-4-methylquinoline-3-carbonitrile (PubChem CID 146040979) has the molecular formula C17H18N4 and a molecular weight of 278.36 g/mol. Its IUPAC name is 2-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-4-methylquinoline-3-carbonitrile.
| Compound Name | 2-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-4-methylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 146040979 |
| Molecular Formula | C17H18N4 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2-[(3aS,6aS)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-4-methylquinoline-3-carbonitrile |
| SMILES | Cc1c(C#N)c(N2C[C@@H]3CCN[C@@H]3C2)nc2ccccc12 |
| InChI | InChI=1S/C17H18N4/c1-11-13-4-2-3-5-15(13)20-17(14(11)8-18)21-9-12-6-7-19-16(12)10-21/h2-5,12,16,19H,6-7,9-10H2,1H3/t12-,16+/m0/s1 |
| InChIKey | GPOBGRCFGVHUIV-BLLLJJGKSA-N |
| XLogP | 2.21 |
| TPSA | 51.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |