C20H22ClFN4O2 — CID 16887200
N'-(3-chloro-4-fluorophenyl)-N-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]methyl]oxamide (PubChem CID 16887200) has the molecular formula C20H22ClFN4O2 and a molecular weight of 404.87 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]methyl]oxamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]methyl]oxamide |
|---|---|
| PubChem CID | 16887200 |
| Molecular Formula | C20H22ClFN4O2 |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-[[1-(pyridin-2-ylmethyl)piperidin-4-yl]methyl]oxamide |
| SMILES | O=C(NCC1CCN(Cc2ccccn2)CC1)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C20H22ClFN4O2/c21-17-11-15(4-5-18(17)22)25-20(28)19(27)24-12-14-6-9-26(10-7-14)13-16-3-1-2-8-23-16/h1-5,8,11,14H,6-7,9-10,12-13H2,(H,24,27)(H,25,28) |
| InChIKey | GRZTUBZNTLUMNM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|