C11H11FO4S — CID 168874395
3-(3-fluorophenyl)sulfonylcyclobutane-1-carboxylic acid (PubChem CID 168874395) has the molecular formula C11H11FO4S and a molecular weight of 258.27 g/mol. Its IUPAC name is 3-(3-fluorophenyl)sulfonylcyclobutane-1-carboxylic acid.
| Compound Name | 3-(3-fluorophenyl)sulfonylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 168874395 |
| Molecular Formula | C11H11FO4S |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 3-(3-fluorophenyl)sulfonylcyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1CC(S(=O)(=O)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C11H11FO4S/c12-8-2-1-3-9(6-8)17(15,16)10-4-7(5-10)11(13)14/h1-3,6-7,10H,4-5H2,(H,13,14) |
| InChIKey | PGKDSVKTEHXBFT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |